C26H40N2O3 — CID 145480495
2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-N-[4-(3-morpholin-4-ylpropoxy)phenyl]acetamide (PubChem CID 145480495) has the molecular formula C26H40N2O3 and a molecular weight of 428.62 g/mol. Its IUPAC name is 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-N-[4-(3-morpholin-4-ylpropoxy)phenyl]acetamide.
| Compound Name | 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-N-[4-(3-morpholin-4-ylpropoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 145480495 |
| Molecular Formula | C26H40N2O3 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | 2-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)-N-[4-(3-morpholin-4-ylpropoxy)phenyl]acetamide |
| SMILES | CC1CC2CC(C1)CC(C)(CC(=O)Nc1ccc(OCCCN3CCOCC3)cc1)C2 |
| InChI | InChI=1S/C26H40N2O3/c1-20-14-21-16-22(15-20)18-26(2,17-21)19-25(29)27-23-4-6-24(7-5-23)31-11-3-8-28-9-12-30-13-10-28/h4-7,20-22H,3,8-19H2,1-2H3,(H,27,29) |
| InChIKey | FZLLQEOUULWONJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|