C23H36N2O4 — CID 100732921
trans-(1S,3R)-1-ethoxy-3-methyl-N-[4-(3-morpholin-4-ylpropoxy)phenyl]cyclohexane-1-carboxamide (PubChem CID 100732921) has the molecular formula C23H36N2O4 and a molecular weight of 404.55 g/mol. Its IUPAC name is trans-(1S,3R)-1-ethoxy-3-methyl-N-[4-(3-morpholin-4-ylpropoxy)phenyl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1S,3R)-1-ethoxy-3-methyl-N-[4-(3-morpholin-4-ylpropoxy)phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100732921 |
| Molecular Formula | C23H36N2O4 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.27 |
| IUPAC Name | trans-(1S,3R)-1-ethoxy-3-methyl-N-[4-(3-morpholin-4-ylpropoxy)phenyl]cyclohexane-1-carboxamide |
| SMILES | CCO[C@@]1(C(=O)Nc2ccc(OCCCN3CCOCC3)cc2)CCC[C@@H](C)C1 |
| InChI | InChI=1S/C23H36N2O4/c1-3-29-23(11-4-6-19(2)18-23)22(26)24-20-7-9-21(10-8-20)28-15-5-12-25-13-16-27-17-14-25/h7-10,19H,3-6,11-18H2,1-2H3,(H,24,26)/t19-,23+/m1/s1 |
| InChIKey | WXZZJTGPLZVFTF-XXBNENTESA-N |
| XLogP | 3.71 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|