C26H42N2O3 — CID 100715354
trans-(1S,3R)-N-[4-[3-(azepan-1-yl)propoxy]phenyl]-3-methyl-1-propoxycyclohexane-1-carboxamide (PubChem CID 100715354) has the molecular formula C26H42N2O3 and a molecular weight of 430.63 g/mol. Its IUPAC name is trans-(1S,3R)-N-[4-[3-(azepan-1-yl)propoxy]phenyl]-3-methyl-1-propoxycyclohexane-1-carboxamide.
| Compound Name | trans-(1S,3R)-N-[4-[3-(azepan-1-yl)propoxy]phenyl]-3-methyl-1-propoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100715354 |
| Molecular Formula | C26H42N2O3 |
| Molecular Weight | 430.63 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | trans-(1S,3R)-N-[4-[3-(azepan-1-yl)propoxy]phenyl]-3-methyl-1-propoxycyclohexane-1-carboxamide |
| SMILES | CCCO[C@@]1(C(=O)Nc2ccc(OCCCN3CCCCCC3)cc2)CCC[C@@H](C)C1 |
| InChI | InChI=1S/C26H42N2O3/c1-3-19-31-26(15-8-10-22(2)21-26)25(29)27-23-11-13-24(14-12-23)30-20-9-18-28-16-6-4-5-7-17-28/h11-14,22H,3-10,15-21H2,1-2H3,(H,27,29)/t22-,26+/m1/s1 |
| InChIKey | JRHCBICLQWPNQT-GJZUVCINSA-N |
| XLogP | 5.65 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.63 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|