C24H38N2O3 — CID 125060712
trans-(1R,3S)-1-methoxy-3-methyl-N-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]cyclohexane-1-carboxamide (PubChem CID 125060712) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is trans-(1R,3S)-1-methoxy-3-methyl-N-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]cyclohexane-1-carboxamide.
| Compound Name | trans-(1R,3S)-1-methoxy-3-methyl-N-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 125060712 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | trans-(1R,3S)-1-methoxy-3-methyl-N-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]cyclohexane-1-carboxamide |
| SMILES | CO[C@]1(C(=O)Nc2ccc(OCCCN3CCC[C@H](C)C3)cc2)CCC[C@H](C)C1 |
| InChI | InChI=1S/C24H38N2O3/c1-19-7-4-13-24(17-19,28-3)23(27)25-21-9-11-22(12-10-21)29-16-6-15-26-14-5-8-20(2)18-26/h9-12,19-20H,4-8,13-18H2,1-3H3,(H,25,27)/t19-,20-,24+/m0/s1 |
| InChIKey | KNHXFUCDABLGTH-MZLICYQSSA-N |
| XLogP | 4.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|