C17H24N2O4 — CID 133246150
N-[4-(2-amino-2-oxoethoxy)phenyl]-1-methoxy-3-methylcyclohexane-1-carboxamide (PubChem CID 133246150) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethoxy)phenyl]-1-methoxy-3-methylcyclohexane-1-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethoxy)phenyl]-1-methoxy-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 133246150 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | N-[4-(2-amino-2-oxoethoxy)phenyl]-1-methoxy-3-methylcyclohexane-1-carboxamide |
| SMILES | COC1(C(=O)Nc2ccc(OCC(N)=O)cc2)CCCC(C)C1 |
| InChI | InChI=1S/C17H24N2O4/c1-12-4-3-9-17(10-12,22-2)16(21)19-13-5-7-14(8-6-13)23-11-15(18)20/h5-8,12H,3-4,9-11H2,1-2H3,(H2,18,20)(H,19,21) |
| InChIKey | JZLOYPJBHGVVCM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |