C18H27NO4 — CID 100706928
cis-(1S,3S)-1-methoxy-N-[4-(2-methoxyethoxy)phenyl]-3-methylcyclohexane-1-carboxamide (PubChem CID 100706928) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is cis-(1S,3S)-1-methoxy-N-[4-(2-methoxyethoxy)phenyl]-3-methylcyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3S)-1-methoxy-N-[4-(2-methoxyethoxy)phenyl]-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100706928 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | cis-(1S,3S)-1-methoxy-N-[4-(2-methoxyethoxy)phenyl]-3-methylcyclohexane-1-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)[C@]2(OC)CCC[C@H](C)C2)cc1 |
| InChI | InChI=1S/C18H27NO4/c1-14-5-4-10-18(13-14,22-3)17(20)19-15-6-8-16(9-7-15)23-12-11-21-2/h6-9,14H,4-5,10-13H2,1-3H3,(H,19,20)/t14-,18-/m0/s1 |
| InChIKey | PIEJPPRDVWPXEM-KSSFIOAISA-N |
| XLogP | 3.25 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|