C17H24BrNO3 — CID 100706082
cis-(1S,3S)-N-[4-(2-bromoethoxy)phenyl]-1-methoxy-3-methylcyclohexane-1-carboxamide (PubChem CID 100706082) has the molecular formula C17H24BrNO3 and a molecular weight of 370.29 g/mol. Its IUPAC name is cis-(1S,3S)-N-[4-(2-bromoethoxy)phenyl]-1-methoxy-3-methylcyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3S)-N-[4-(2-bromoethoxy)phenyl]-1-methoxy-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100706082 |
| Molecular Formula | C17H24BrNO3 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | cis-(1S,3S)-N-[4-(2-bromoethoxy)phenyl]-1-methoxy-3-methylcyclohexane-1-carboxamide |
| SMILES | CO[C@@]1(C(=O)Nc2ccc(OCCBr)cc2)CCC[C@H](C)C1 |
| InChI | InChI=1S/C17H24BrNO3/c1-13-4-3-9-17(12-13,21-2)16(20)19-14-5-7-15(8-6-14)22-11-10-18/h5-8,13H,3-4,9-12H2,1-2H3,(H,19,20)/t13-,17-/m0/s1 |
| InChIKey | YEXIDDHSTKHEFH-GUYCJALGSA-N |
| XLogP | 3.99 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|