C17H26N2O4 — CID 100775383
cis-(1S,3S)-1-methoxy-N-[6-(2-methoxyethoxy)-3-pyridinyl]-3-methylcyclohexane-1-carboxamide (PubChem CID 100775383) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is cis-(1S,3S)-1-methoxy-N-[6-(2-methoxyethoxy)-3-pyridinyl]-3-methylcyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3S)-1-methoxy-N-[6-(2-methoxyethoxy)-3-pyridinyl]-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100775383 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | cis-(1S,3S)-1-methoxy-N-[6-(2-methoxyethoxy)-3-pyridinyl]-3-methylcyclohexane-1-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)[C@]2(OC)CCC[C@H](C)C2)cn1 |
| InChI | InChI=1S/C17H26N2O4/c1-13-5-4-8-17(11-13,22-3)16(20)19-14-6-7-15(18-12-14)23-10-9-21-2/h6-7,12-13H,4-5,8-11H2,1-3H3,(H,19,20)/t13-,17-/m0/s1 |
| InChIKey | RQJJKRFTGJXTBR-GUYCJALGSA-N |
| XLogP | 2.64 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|