C18H28N2O4 — CID 100777116
cis-(1S,3S)-1-ethoxy-N-[6-(2-methoxyethoxy)-3-pyridinyl]-3-methylcyclohexane-1-carboxamide (PubChem CID 100777116) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is cis-(1S,3S)-1-ethoxy-N-[6-(2-methoxyethoxy)-3-pyridinyl]-3-methylcyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3S)-1-ethoxy-N-[6-(2-methoxyethoxy)-3-pyridinyl]-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100777116 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | cis-(1S,3S)-1-ethoxy-N-[6-(2-methoxyethoxy)-3-pyridinyl]-3-methylcyclohexane-1-carboxamide |
| SMILES | CCO[C@@]1(C(=O)Nc2ccc(OCCOC)nc2)CCC[C@H](C)C1 |
| InChI | InChI=1S/C18H28N2O4/c1-4-24-18(9-5-6-14(2)12-18)17(21)20-15-7-8-16(19-13-15)23-11-10-22-3/h7-8,13-14H,4-6,9-12H2,1-3H3,(H,20,21)/t14-,18-/m0/s1 |
| InChIKey | RTGLMOAYCMKHFZ-KSSFIOAISA-N |
| XLogP | 3.03 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|