C18H26ClNO4 — CID 100707699
trans-(1R,3S)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-1-methoxy-3-methylcyclohexane-1-carboxamide (PubChem CID 100707699) has the molecular formula C18H26ClNO4 and a molecular weight of 355.86 g/mol. Its IUPAC name is trans-(1R,3S)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-1-methoxy-3-methylcyclohexane-1-carboxamide.
| Compound Name | trans-(1R,3S)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-1-methoxy-3-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100707699 |
| Molecular Formula | C18H26ClNO4 |
| Molecular Weight | 355.86 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | trans-(1R,3S)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-1-methoxy-3-methylcyclohexane-1-carboxamide |
| SMILES | COCCOc1ccc(NC(=O)[C@@]2(OC)CCC[C@H](C)C2)cc1Cl |
| InChI | InChI=1S/C18H26ClNO4/c1-13-5-4-8-18(12-13,23-3)17(21)20-14-6-7-16(15(19)11-14)24-10-9-22-2/h6-7,11,13H,4-5,8-10,12H2,1-3H3,(H,20,21)/t13-,18+/m0/s1 |
| InChIKey | WNSKZVNYQVWWOU-SCLBCKFNSA-N |
| XLogP | 3.90 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.86 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|