C22H34N2O2 — CID 100692055
1-methyl-N-[4-[3-[(3R)-3-methylpiperidin-1-yl]propoxy]phenyl]cyclopentane-1-carboxamide (PubChem CID 100692055) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 1-methyl-N-[4-[3-[(3R)-3-methylpiperidin-1-yl]propoxy]phenyl]cyclopentane-1-carboxamide.
| Compound Name | 1-methyl-N-[4-[3-[(3R)-3-methylpiperidin-1-yl]propoxy]phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 100692055 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 1-methyl-N-[4-[3-[(3R)-3-methylpiperidin-1-yl]propoxy]phenyl]cyclopentane-1-carboxamide |
| SMILES | C[C@@H]1CCCN(CCCOc2ccc(NC(=O)C3(C)CCCC3)cc2)C1 |
| InChI | InChI=1S/C22H34N2O2/c1-18-7-5-14-24(17-18)15-6-16-26-20-10-8-19(9-11-20)23-21(25)22(2)12-3-4-13-22/h8-11,18H,3-7,12-17H2,1-2H3,(H,23,25)/t18-/m1/s1 |
| InChIKey | DDCMYQBBIRAXAD-GOSISDBHSA-N |
| XLogP | 4.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|