C27H36N2O2 — CID 100669431
N-[4-[2-[(3S)-3-methylpiperidin-1-yl]ethoxy]phenyl]-1-phenylcyclohexane-1-carboxamide (PubChem CID 100669431) has the molecular formula C27H36N2O2 and a molecular weight of 420.60 g/mol. Its IUPAC name is N-[4-[2-[(3S)-3-methylpiperidin-1-yl]ethoxy]phenyl]-1-phenylcyclohexane-1-carboxamide.
| Compound Name | N-[4-[2-[(3S)-3-methylpiperidin-1-yl]ethoxy]phenyl]-1-phenylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100669431 |
| Molecular Formula | C27H36N2O2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.28 |
| IUPAC Name | N-[4-[2-[(3S)-3-methylpiperidin-1-yl]ethoxy]phenyl]-1-phenylcyclohexane-1-carboxamide |
| SMILES | C[C@H]1CCCN(CCOc2ccc(NC(=O)C3(c4ccccc4)CCCCC3)cc2)C1 |
| InChI | InChI=1S/C27H36N2O2/c1-22-9-8-18-29(21-22)19-20-31-25-14-12-24(13-15-25)28-26(30)27(16-6-3-7-17-27)23-10-4-2-5-11-23/h2,4-5,10-15,22H,3,6-9,16-21H2,1H3,(H,28,30)/t22-/m0/s1 |
| InChIKey | NCYUACLXDJQWKA-QFIPXVFZSA-N |
| XLogP | 5.64 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |