C24H38N2O4 — CID 100715258
cis-(1S,3S)-3-methyl-N-[4-(3-morpholin-4-ylpropoxy)phenyl]-1-propoxycyclohexane-1-carboxamide (PubChem CID 100715258) has the molecular formula C24H38N2O4 and a molecular weight of 418.58 g/mol. Its IUPAC name is cis-(1S,3S)-3-methyl-N-[4-(3-morpholin-4-ylpropoxy)phenyl]-1-propoxycyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3S)-3-methyl-N-[4-(3-morpholin-4-ylpropoxy)phenyl]-1-propoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 100715258 |
| Molecular Formula | C24H38N2O4 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | cis-(1S,3S)-3-methyl-N-[4-(3-morpholin-4-ylpropoxy)phenyl]-1-propoxycyclohexane-1-carboxamide |
| SMILES | CCCO[C@@]1(C(=O)Nc2ccc(OCCCN3CCOCC3)cc2)CCC[C@H](C)C1 |
| InChI | InChI=1S/C24H38N2O4/c1-3-15-30-24(11-4-6-20(2)19-24)23(27)25-21-7-9-22(10-8-21)29-16-5-12-26-13-17-28-18-14-26/h7-10,20H,3-6,11-19H2,1-2H3,(H,25,27)/t20-,24-/m0/s1 |
| InChIKey | BIYGRPLNYPGHIR-RDPSFJRHSA-N |
| XLogP | 4.10 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|