C27H40N2O3 — CID 68977864
2-(1-adamantyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]butanamide (PubChem CID 68977864) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]butanamide.
| Compound Name | 2-(1-adamantyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 68977864 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | 2-(1-adamantyl)-N-[3-(3-morpholin-4-ylpropoxy)phenyl]butanamide |
| SMILES | CCC(C(=O)Nc1cccc(OCCCN2CCOCC2)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H40N2O3/c1-2-25(27-17-20-13-21(18-27)15-22(14-20)19-27)26(30)28-23-5-3-6-24(16-23)32-10-4-7-29-8-11-31-12-9-29/h3,5-6,16,20-22,25H,2,4,7-15,17-19H2,1H3,(H,28,30) |
| InChIKey | VWRVBQFLALWGPR-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|