C20H23BrN2O4 — CID 91937888
N-(3-bromophenyl)-2-hydroxy-4-(3-morpholin-4-ylpropoxy)benzamide (PubChem CID 91937888) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-hydroxy-4-(3-morpholin-4-ylpropoxy)benzamide.
| Compound Name | N-(3-bromophenyl)-2-hydroxy-4-(3-morpholin-4-ylpropoxy)benzamide |
|---|---|
| PubChem CID | 91937888 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | N-(3-bromophenyl)-2-hydroxy-4-(3-morpholin-4-ylpropoxy)benzamide |
| SMILES | O=C(Nc1cccc(Br)c1)c1ccc(OCCCN2CCOCC2)cc1O |
| InChI | InChI=1S/C20H23BrN2O4/c21-15-3-1-4-16(13-15)22-20(25)18-6-5-17(14-19(18)24)27-10-2-7-23-8-11-26-12-9-23/h1,3-6,13-14,24H,2,7-12H2,(H,22,25) |
| InChIKey | UHIGGIAEEFEQGV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|