C26H29N3O4 — CID 56675699
N-(3-hydroxyphenyl)-2-(pyridin-3-ylmethoxy)-4-(3-pyrrolidin-1-ylpropoxy)benzamide (PubChem CID 56675699) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is N-(3-hydroxyphenyl)-2-(pyridin-3-ylmethoxy)-4-(3-pyrrolidin-1-ylpropoxy)benzamide.
| Compound Name | N-(3-hydroxyphenyl)-2-(pyridin-3-ylmethoxy)-4-(3-pyrrolidin-1-ylpropoxy)benzamide |
|---|---|
| PubChem CID | 56675699 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | N-(3-hydroxyphenyl)-2-(pyridin-3-ylmethoxy)-4-(3-pyrrolidin-1-ylpropoxy)benzamide |
| SMILES | O=C(Nc1cccc(O)c1)c1ccc(OCCCN2CCCC2)cc1OCc1cccnc1 |
| InChI | InChI=1S/C26H29N3O4/c30-22-8-3-7-21(16-22)28-26(31)24-10-9-23(32-15-5-14-29-12-1-2-13-29)17-25(24)33-19-20-6-4-11-27-18-20/h3-4,6-11,16-18,30H,1-2,5,12-15,19H2,(H,28,31) |
| InChIKey | VVVKRAXPLJPTMG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|