C24H30N2O2 — CID 143220096
1-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-3-(3-phenoxyphenyl)urea (PubChem CID 143220096) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-3-(3-phenoxyphenyl)urea.
| Compound Name | 1-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-3-(3-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 143220096 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)-3-(3-phenoxyphenyl)urea |
| SMILES | CC1CC2CC(C)CC(NC(=O)Nc3cccc(Oc4ccccc4)c3)(C1)C2 |
| InChI | InChI=1S/C24H30N2O2/c1-17-11-19-12-18(2)15-24(14-17,16-19)26-23(27)25-20-7-6-10-22(13-20)28-21-8-4-3-5-9-21/h3-10,13,17-19H,11-12,14-16H2,1-2H3,(H2,25,26,27) |
| InChIKey | GDIKZNINHHJQCJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |