C18H22F2N2O2 — CID 70694281
1-(1-adamantyl)-3-[3-(difluoromethoxy)phenyl]urea (PubChem CID 70694281) has the molecular formula C18H22F2N2O2 and a molecular weight of 336.38 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[3-(difluoromethoxy)phenyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[3-(difluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 70694281 |
| Molecular Formula | C18H22F2N2O2 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 1-(1-adamantyl)-3-[3-(difluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1cccc(OC(F)F)c1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H22F2N2O2/c19-16(20)24-15-3-1-2-14(7-15)21-17(23)22-18-8-11-4-12(9-18)6-13(5-11)10-18/h1-3,7,11-13,16H,4-6,8-10H2,(H2,21,22,23) |
| InChIKey | JKXNSDPOYNVZSD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |