C14H16F2N2O2 — CID 169150536
1-(1-bicyclo[1.1.1]pentanyl)-3-[[3-(difluoromethoxy)phenyl]methyl]urea (PubChem CID 169150536) has the molecular formula C14H16F2N2O2 and a molecular weight of 282.29 g/mol. Its IUPAC name is 1-(1-bicyclo[1.1.1]pentanyl)-3-[[3-(difluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-(1-bicyclo[1.1.1]pentanyl)-3-[[3-(difluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 169150536 |
| Molecular Formula | C14H16F2N2O2 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-(1-bicyclo[1.1.1]pentanyl)-3-[[3-(difluoromethoxy)phenyl]methyl]urea |
| SMILES | O=C(NCc1cccc(OC(F)F)c1)NC12CC(C1)C2 |
| InChI | InChI=1S/C14H16F2N2O2/c15-12(16)20-11-3-1-2-9(4-11)8-17-13(19)18-14-5-10(6-14)7-14/h1-4,10,12H,5-8H2,(H2,17,18,19) |
| InChIKey | CJSXOVUBQJDHIZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |