C14H14F2N2O3 — CID 49479533
1-[[3-(difluoromethoxy)phenyl]methyl]-3-(furan-3-ylmethyl)urea (PubChem CID 49479533) has the molecular formula C14H14F2N2O3 and a molecular weight of 296.27 g/mol. Its IUPAC name is 1-[[3-(difluoromethoxy)phenyl]methyl]-3-(furan-3-ylmethyl)urea.
| Compound Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-3-(furan-3-ylmethyl)urea |
|---|---|
| PubChem CID | 49479533 |
| Molecular Formula | C14H14F2N2O3 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-[[3-(difluoromethoxy)phenyl]methyl]-3-(furan-3-ylmethyl)urea |
| SMILES | O=C(NCc1ccoc1)NCc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C14H14F2N2O3/c15-13(16)21-12-3-1-2-10(6-12)7-17-14(19)18-8-11-4-5-20-9-11/h1-6,9,13H,7-8H2,(H2,17,18,19) |
| InChIKey | IUTJFVABCMOMKM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |