C12H10F2N2O2 — CID 47038823
1-(2,6-difluorophenyl)-3-(furan-3-ylmethyl)urea (PubChem CID 47038823) has the molecular formula C12H10F2N2O2 and a molecular weight of 252.22 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(furan-3-ylmethyl)urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-(furan-3-ylmethyl)urea |
|---|---|
| PubChem CID | 47038823 |
| Molecular Formula | C12H10F2N2O2 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(furan-3-ylmethyl)urea |
| SMILES | O=C(NCc1ccoc1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C12H10F2N2O2/c13-9-2-1-3-10(14)11(9)16-12(17)15-6-8-4-5-18-7-8/h1-5,7H,6H2,(H2,15,16,17) |
| InChIKey | FAVRERILEQWDNR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |