C10H11N3O3 — CID 154857494
1-(furan-3-ylmethyl)-3-(3-methyl-1,2-oxazol-5-yl)urea (PubChem CID 154857494) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is 1-(furan-3-ylmethyl)-3-(3-methyl-1,2-oxazol-5-yl)urea.
| Compound Name | 1-(furan-3-ylmethyl)-3-(3-methyl-1,2-oxazol-5-yl)urea |
|---|---|
| PubChem CID | 154857494 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 1-(furan-3-ylmethyl)-3-(3-methyl-1,2-oxazol-5-yl)urea |
| SMILES | Cc1cc(NC(=O)NCc2ccoc2)on1 |
| InChI | InChI=1S/C10H11N3O3/c1-7-4-9(16-13-7)12-10(14)11-5-8-2-3-15-6-8/h2-4,6H,5H2,1H3,(H2,11,12,14) |
| InChIKey | IFHZKHMPYSRUAT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |