C17H16N4O2 — CID 154857483
1-(3-methyl-1,2-oxazol-5-yl)-3-[4-(pyridin-4-ylmethyl)phenyl]urea (PubChem CID 154857483) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 1-(3-methyl-1,2-oxazol-5-yl)-3-[4-(pyridin-4-ylmethyl)phenyl]urea.
| Compound Name | 1-(3-methyl-1,2-oxazol-5-yl)-3-[4-(pyridin-4-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 154857483 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 1-(3-methyl-1,2-oxazol-5-yl)-3-[4-(pyridin-4-ylmethyl)phenyl]urea |
| SMILES | Cc1cc(NC(=O)Nc2ccc(Cc3ccncc3)cc2)on1 |
| InChI | InChI=1S/C17H16N4O2/c1-12-10-16(23-21-12)20-17(22)19-15-4-2-13(3-5-15)11-14-6-8-18-9-7-14/h2-10H,11H2,1H3,(H2,19,20,22) |
| InChIKey | XSWBYFYLFGGSTQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |