C16H21N3O2 — CID 143052561
1-(3-tert-butyl-1,2-oxazol-5-yl)-3-(4-ethylphenyl)urea (PubChem CID 143052561) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2-oxazol-5-yl)-3-(4-ethylphenyl)urea.
| Compound Name | 1-(3-tert-butyl-1,2-oxazol-5-yl)-3-(4-ethylphenyl)urea |
|---|---|
| PubChem CID | 143052561 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-(3-tert-butyl-1,2-oxazol-5-yl)-3-(4-ethylphenyl)urea |
| SMILES | CCc1ccc(NC(=O)Nc2cc(C(C)(C)C)no2)cc1 |
| InChI | InChI=1S/C16H21N3O2/c1-5-11-6-8-12(9-7-11)17-15(20)18-14-10-13(19-21-14)16(2,3)4/h6-10H,5H2,1-4H3,(H2,17,18,20) |
| InChIKey | KEJAHNKCQYDWIQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |