C19H21N5O2 — CID 51030162
1-[4-(6-amino-3-pyridinyl)phenyl]-3-(3-tert-butyl-1,2-oxazol-5-yl)urea (PubChem CID 51030162) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 1-[4-(6-amino-3-pyridinyl)phenyl]-3-(3-tert-butyl-1,2-oxazol-5-yl)urea.
| Compound Name | 1-[4-(6-amino-3-pyridinyl)phenyl]-3-(3-tert-butyl-1,2-oxazol-5-yl)urea |
|---|---|
| PubChem CID | 51030162 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 1-[4-(6-amino-3-pyridinyl)phenyl]-3-(3-tert-butyl-1,2-oxazol-5-yl)urea |
| SMILES | CC(C)(C)c1cc(NC(=O)Nc2ccc(-c3ccc(N)nc3)cc2)on1 |
| InChI | InChI=1S/C19H21N5O2/c1-19(2,3)15-10-17(26-24-15)23-18(25)22-14-7-4-12(5-8-14)13-6-9-16(20)21-11-13/h4-11H,1-3H3,(H2,20,21)(H2,22,23,25) |
| InChIKey | ZRYOMQRSRSJWQS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |