C13H18N4O2S — CID 170059357
1-(3-tert-butyl-1,2-oxazol-5-yl)-3-(5-ethyl-1,3-thiazol-2-yl)urea (PubChem CID 170059357) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2-oxazol-5-yl)-3-(5-ethyl-1,3-thiazol-2-yl)urea.
| Compound Name | 1-(3-tert-butyl-1,2-oxazol-5-yl)-3-(5-ethyl-1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 170059357 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-(3-tert-butyl-1,2-oxazol-5-yl)-3-(5-ethyl-1,3-thiazol-2-yl)urea |
| SMILES | CCc1cnc(NC(=O)Nc2cc(C(C)(C)C)no2)s1 |
| InChI | InChI=1S/C13H18N4O2S/c1-5-8-7-14-12(20-8)16-11(18)15-10-6-9(17-19-10)13(2,3)4/h6-7H,5H2,1-4H3,(H2,14,15,16,18) |
| InChIKey | ONVJDSORXGSSBC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |