C18H25N3O2 — CID 59380959
1-(3-tert-butyl-1,2-oxazol-5-yl)-3-(4-tert-butylphenyl)urea (PubChem CID 59380959) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 1-(3-tert-butyl-1,2-oxazol-5-yl)-3-(4-tert-butylphenyl)urea.
| Compound Name | 1-(3-tert-butyl-1,2-oxazol-5-yl)-3-(4-tert-butylphenyl)urea |
|---|---|
| PubChem CID | 59380959 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 1-(3-tert-butyl-1,2-oxazol-5-yl)-3-(4-tert-butylphenyl)urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)Nc2cc(C(C)(C)C)no2)cc1 |
| InChI | InChI=1S/C18H25N3O2/c1-17(2,3)12-7-9-13(10-8-12)19-16(22)20-15-11-14(21-23-15)18(4,5)6/h7-11H,1-6H3,(H2,19,20,22) |
| InChIKey | JRWWQNVINJYCFR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |