About 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide
4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide (PubChem CID 102851049) has the molecular formula C15H17BrN2O2
and a molecular weight of 337.22 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide.
Molecular Properties
| Compound Name | 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide |
| PubChem CID | 102851049 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide |
| SMILES | CC(C)(C)c1cc(NC(=O)c2ccc(CBr)cc2)on1 |
| InChI | InChI=1S/C15H17BrN2O2/c1-15(2,3)12-8-13(20-18-12)17-14(19)11-6-4-10(9-16)5-7-11/h4-8H,9H2,1-3H3,(H,17,19) |
| InChIKey | SSRNELCXGCVLBA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide?
The IUPAC name of 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide (CID 102851049) is 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide.
What is the SMILES notation for 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide?
The canonical SMILES for 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide is CC(C)(C)c1cc(NC(=O)c2ccc(CBr)cc2)on1.
What is the InChIKey of 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide?
The InChIKey is SSRNELCXGCVLBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrN2O2/c1-15(2,3)12-8-13(20-18-12)17-14(19)11-6-4-10(9-16)5-7-11/h4-8H,9H2,1-3H3,(H,17,19).
What are the key properties of 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide?
4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide has a molecular weight of 337.22 g/mol, XLogP of 4.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-N-(3-tert-butyl-1,2-oxazol-5-yl)benzamide is sourced from PubChem (CID 102851049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).