C15H17ClN2O2 — CID 59420457
N-(3-tert-butyl-1,2-oxazol-5-yl)-2-(4-chlorophenyl)acetamide (PubChem CID 59420457) has the molecular formula C15H17ClN2O2 and a molecular weight of 292.77 g/mol. Its IUPAC name is N-(3-tert-butyl-1,2-oxazol-5-yl)-2-(4-chlorophenyl)acetamide.
| Compound Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 59420457 |
| Molecular Formula | C15H17ClN2O2 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-2-(4-chlorophenyl)acetamide |
| SMILES | CC(C)(C)c1cc(NC(=O)Cc2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C15H17ClN2O2/c1-15(2,3)12-9-14(20-18-12)17-13(19)8-10-4-6-11(16)7-5-10/h4-7,9H,8H2,1-3H3,(H,17,19) |
| InChIKey | VDIQYJAQKVUNLY-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |