C18H22N2O3 — CID 59420462
N-(3-tert-butyl-1,2-oxazol-5-yl)-2-(4-prop-2-enoxyphenyl)acetamide (PubChem CID 59420462) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-(3-tert-butyl-1,2-oxazol-5-yl)-2-(4-prop-2-enoxyphenyl)acetamide.
| Compound Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-2-(4-prop-2-enoxyphenyl)acetamide |
|---|---|
| PubChem CID | 59420462 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-(3-tert-butyl-1,2-oxazol-5-yl)-2-(4-prop-2-enoxyphenyl)acetamide |
| SMILES | C=CCOc1ccc(CC(=O)Nc2cc(C(C)(C)C)no2)cc1 |
| InChI | InChI=1S/C18H22N2O3/c1-5-10-22-14-8-6-13(7-9-14)11-16(21)19-17-12-15(20-23-17)18(2,3)4/h5-9,12H,1,10-11H2,2-4H3,(H,19,21) |
| InChIKey | YBTDUSQHLHEQTB-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|