C22H27N7O3 — CID 70993574
1-[4-[4-amino-6-(1-hydroxyethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(3-tert-butyl-1,2-oxazol-5-yl)urea (PubChem CID 70993574) has the molecular formula C22H27N7O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-[4-[4-amino-6-(1-hydroxyethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(3-tert-butyl-1,2-oxazol-5-yl)urea.
| Compound Name | 1-[4-[4-amino-6-(1-hydroxyethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(3-tert-butyl-1,2-oxazol-5-yl)urea |
|---|---|
| PubChem CID | 70993574 |
| Molecular Formula | C22H27N7O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | 1-[4-[4-amino-6-(1-hydroxyethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazin-5-yl]phenyl]-3-(3-tert-butyl-1,2-oxazol-5-yl)urea |
| SMILES | CC(O)C1CN2N=CN=C(N)C2=C1c1ccc(NC(=O)Nc2cc(C(C)(C)C)no2)cc1 |
| InChI | InChI=1S/C22H27N7O3/c1-12(30)15-10-29-19(20(23)24-11-25-29)18(15)13-5-7-14(8-6-13)26-21(31)27-17-9-16(28-32-17)22(2,3)4/h5-9,11-12,15,30H,10H2,1-4H3,(H2,23,24,25)(H2,26,27,31) |
| InChIKey | ZMWUNKBLWPIZEX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |