C26H30F3N9O2 — CID 70910828
4-amino-N-[4-(dimethylamino)butyl]-5-[4-[[6-(trifluoromethyl)-2-pyridinyl]carbamoylamino]phenyl]-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 70910828) has the molecular formula C26H30F3N9O2 and a molecular weight of 557.58 g/mol. Its IUPAC name is 4-amino-N-[4-(dimethylamino)butyl]-5-[4-[[6-(trifluoromethyl)-2-pyridinyl]carbamoylamino]phenyl]-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | 4-amino-N-[4-(dimethylamino)butyl]-5-[4-[[6-(trifluoromethyl)-2-pyridinyl]carbamoylamino]phenyl]-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 70910828 |
| Molecular Formula | C26H30F3N9O2 |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 4-amino-N-[4-(dimethylamino)butyl]-5-[4-[[6-(trifluoromethyl)-2-pyridinyl]carbamoylamino]phenyl]-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | CN(C)CCCCNC(=O)C1CN2N=CN=C(N)C2=C1c1ccc(NC(=O)Nc2cccc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C26H30F3N9O2/c1-37(2)13-4-3-12-31-24(39)18-14-38-22(23(30)32-15-33-38)21(18)16-8-10-17(11-9-16)34-25(40)36-20-7-5-6-19(35-20)26(27,28)29/h5-11,15,18H,3-4,12-14H2,1-2H3,(H,31,39)(H2,30,32,33)(H2,34,35,36,40) |
| InChIKey | INQLQCHHOOUMNC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|