C24H23ClF3N7O3 — CID 70993556
4-amino-5-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-N-(2-methoxyethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide (PubChem CID 70993556) has the molecular formula C24H23ClF3N7O3 and a molecular weight of 549.94 g/mol. Its IUPAC name is 4-amino-5-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-N-(2-methoxyethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide.
| Compound Name | 4-amino-5-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-N-(2-methoxyethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
|---|---|
| PubChem CID | 70993556 |
| Molecular Formula | C24H23ClF3N7O3 |
| Molecular Weight | 549.94 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | 4-amino-5-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenyl]-N-(2-methoxyethyl)-6,7-dihydropyrrolo[2,1-f][1,2,4]triazine-6-carboxamide |
| SMILES | COCCNC(=O)C1CN2N=CN=C(N)C2=C1c1ccc(NC(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H23ClF3N7O3/c1-38-9-8-30-22(36)16-11-35-20(21(29)31-12-32-35)19(16)13-2-4-14(5-3-13)33-23(37)34-15-6-7-18(25)17(10-15)24(26,27)28/h2-7,10,12,16H,8-9,11H2,1H3,(H,30,36)(H2,29,31,32)(H2,33,34,37) |
| InChIKey | OXTNMPNUDLEZQN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.94 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|