C15H16ClF3N2O3 — CID 108972828
1-N'-[4-chloro-3-(trifluoromethyl)phenyl]-1-N-(2-methoxyethyl)cyclopropane-1,1-dicarboxamide (PubChem CID 108972828) has the molecular formula C15H16ClF3N2O3 and a molecular weight of 364.75 g/mol. Its IUPAC name is 1-N'-[4-chloro-3-(trifluoromethyl)phenyl]-1-N-(2-methoxyethyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-chloro-3-(trifluoromethyl)phenyl]-1-N-(2-methoxyethyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 108972828 |
| Molecular Formula | C15H16ClF3N2O3 |
| Molecular Weight | 364.75 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-N'-[4-chloro-3-(trifluoromethyl)phenyl]-1-N-(2-methoxyethyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COCCNC(=O)C1(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H16ClF3N2O3/c1-24-7-6-20-12(22)14(4-5-14)13(23)21-9-2-3-11(16)10(8-9)15(17,18)19/h2-3,8H,4-7H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | ALXMHBVBHHTARA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.75 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|