C16H15ClF3N3O2 — CID 109153089
6-[4-chloro-3-(trifluoromethyl)anilino]-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 109153089) has the molecular formula C16H15ClF3N3O2 and a molecular weight of 373.76 g/mol. Its IUPAC name is 6-[4-chloro-3-(trifluoromethyl)anilino]-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | 6-[4-chloro-3-(trifluoromethyl)anilino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109153089 |
| Molecular Formula | C16H15ClF3N3O2 |
| Molecular Weight | 373.76 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 6-[4-chloro-3-(trifluoromethyl)anilino]-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1ccc(Nc2ccc(Cl)c(C(F)(F)F)c2)nc1 |
| InChI | InChI=1S/C16H15ClF3N3O2/c1-25-7-6-21-15(24)10-2-5-14(22-9-10)23-11-3-4-13(17)12(8-11)16(18,19)20/h2-5,8-9H,6-7H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | JEWNSYPYVLNELM-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.76 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|