C12H19N3O4 — CID 43466444
3-[[2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl]amino]propanoic acid (PubChem CID 43466444) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 3-[[2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl]amino]propanoic acid.
| Compound Name | 3-[[2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43466444 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-[[2-[(3-tert-butyl-1,2-oxazol-5-yl)amino]-2-oxoethyl]amino]propanoic acid |
| SMILES | CC(C)(C)c1cc(NC(=O)CNCCC(=O)O)on1 |
| InChI | InChI=1S/C12H19N3O4/c1-12(2,3)8-6-10(19-15-8)14-9(16)7-13-5-4-11(17)18/h6,13H,4-5,7H2,1-3H3,(H,14,16)(H,17,18) |
| InChIKey | TYQNJDIVCVYEBO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|