About 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea
1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea (PubChem CID 90203017) has the molecular formula C7H12N4O3
and a molecular weight of 200.20 g/mol. Its IUPAC name is 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea.
Molecular Properties
| Compound Name | 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea |
| PubChem CID | 90203017 |
| Molecular Formula | C7H12N4O3 |
| Molecular Weight | 200.20 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea |
| SMILES | Cc1cc(NC(=O)NNCCO)on1 |
| InChI | InChI=1S/C7H12N4O3/c1-5-4-6(14-11-5)9-7(13)10-8-2-3-12/h4,8,12H,2-3H2,1H3,(H2,9,10,13) |
| InChIKey | ZEKLKFINMWPHOU-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 99.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.20 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea?
The IUPAC name of 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea (CID 90203017) is 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea.
What is the SMILES notation for 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea?
The canonical SMILES for 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea is Cc1cc(NC(=O)NNCCO)on1.
What is the InChIKey of 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea?
The InChIKey is ZEKLKFINMWPHOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O3/c1-5-4-6(14-11-5)9-7(13)10-8-2-3-12/h4,8,12H,2-3H2,1H3,(H2,9,10,13).
What are the key properties of 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea?
1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea has a molecular weight of 200.20 g/mol, XLogP of -0.40, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethylamino)-3-(3-methyl-1,2-oxazol-5-yl)urea is sourced from PubChem (CID 90203017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).