C11H13N5O2 — CID 166274717
1-(3-methyl-1,2-oxazol-5-yl)-3-(2-pyrimidin-2-ylethyl)urea (PubChem CID 166274717) has the molecular formula C11H13N5O2 and a molecular weight of 247.26 g/mol. Its IUPAC name is 1-(3-methyl-1,2-oxazol-5-yl)-3-(2-pyrimidin-2-ylethyl)urea.
| Compound Name | 1-(3-methyl-1,2-oxazol-5-yl)-3-(2-pyrimidin-2-ylethyl)urea |
|---|---|
| PubChem CID | 166274717 |
| Molecular Formula | C11H13N5O2 |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 1-(3-methyl-1,2-oxazol-5-yl)-3-(2-pyrimidin-2-ylethyl)urea |
| SMILES | Cc1cc(NC(=O)NCCc2ncccn2)on1 |
| InChI | InChI=1S/C11H13N5O2/c1-8-7-10(18-16-8)15-11(17)14-6-3-9-12-4-2-5-13-9/h2,4-5,7H,3,6H2,1H3,(H2,14,15,17) |
| InChIKey | GDBSMJJMBCGRIN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |