C7H9ClN2O2 — CID 40953774
(2R)-2-chloro-N-(3-methyl-1,2-oxazol-5-yl)propanamide (PubChem CID 40953774) has the molecular formula C7H9ClN2O2 and a molecular weight of 188.61 g/mol. Its IUPAC name is (2R)-2-chloro-N-(3-methyl-1,2-oxazol-5-yl)propanamide.
| Compound Name | (2R)-2-chloro-N-(3-methyl-1,2-oxazol-5-yl)propanamide |
|---|---|
| PubChem CID | 40953774 |
| Molecular Formula | C7H9ClN2O2 |
| Molecular Weight | 188.61 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | (2R)-2-chloro-N-(3-methyl-1,2-oxazol-5-yl)propanamide |
| SMILES | Cc1cc(NC(=O)[C@@H](C)Cl)on1 |
| InChI | InChI=1S/C7H9ClN2O2/c1-4-3-6(12-10-4)9-7(11)5(2)8/h3,5H,1-2H3,(H,9,11)/t5-/m1/s1 |
| InChIKey | DMJOCQUVYRWOHI-RXMQYKEDSA-N |
| XLogP | 1.55 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.61 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|