C9H15N3O2 — CID 81071258
4-amino-3-methyl-N-(3-methyl-1,2-oxazol-5-yl)butanamide (PubChem CID 81071258) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-amino-3-methyl-N-(3-methyl-1,2-oxazol-5-yl)butanamide.
| Compound Name | 4-amino-3-methyl-N-(3-methyl-1,2-oxazol-5-yl)butanamide |
|---|---|
| PubChem CID | 81071258 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4-amino-3-methyl-N-(3-methyl-1,2-oxazol-5-yl)butanamide |
| SMILES | Cc1cc(NC(=O)CC(C)CN)on1 |
| InChI | InChI=1S/C9H15N3O2/c1-6(5-10)3-8(13)11-9-4-7(2)12-14-9/h4,6H,3,5,10H2,1-2H3,(H,11,13) |
| InChIKey | XTKNZSPCOPAVTB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |