C14H17N3O2 — CID 104501972
3-(4-aminophenyl)-N-(3-methyl-1,2-oxazol-5-yl)butanamide (PubChem CID 104501972) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-(3-methyl-1,2-oxazol-5-yl)butanamide.
| Compound Name | 3-(4-aminophenyl)-N-(3-methyl-1,2-oxazol-5-yl)butanamide |
|---|---|
| PubChem CID | 104501972 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3-(4-aminophenyl)-N-(3-methyl-1,2-oxazol-5-yl)butanamide |
| SMILES | Cc1cc(NC(=O)CC(C)c2ccc(N)cc2)on1 |
| InChI | InChI=1S/C14H17N3O2/c1-9(11-3-5-12(15)6-4-11)7-13(18)16-14-8-10(2)17-19-14/h3-6,8-9H,7,15H2,1-2H3,(H,16,18) |
| InChIKey | RAIOHMBQYHJFFP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|