C13H15N3O2 — CID 104502578
3-(4-aminophenyl)-N-(1,2-oxazol-3-yl)butanamide (PubChem CID 104502578) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-(1,2-oxazol-3-yl)butanamide.
| Compound Name | 3-(4-aminophenyl)-N-(1,2-oxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 104502578 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 3-(4-aminophenyl)-N-(1,2-oxazol-3-yl)butanamide |
| SMILES | CC(CC(=O)Nc1ccon1)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H15N3O2/c1-9(10-2-4-11(14)5-3-10)8-13(17)15-12-6-7-18-16-12/h2-7,9H,8,14H2,1H3,(H,15,16,17) |
| InChIKey | DWZXTVYWPGBOJK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|