C7H8N2O3 — CID 62902230
N-(1,2-oxazol-3-yl)-3-oxobutanamide (PubChem CID 62902230) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is N-(1,2-oxazol-3-yl)-3-oxobutanamide.
| Compound Name | N-(1,2-oxazol-3-yl)-3-oxobutanamide |
|---|---|
| PubChem CID | 62902230 |
| Molecular Formula | C7H8N2O3 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | N-(1,2-oxazol-3-yl)-3-oxobutanamide |
| SMILES | CC(=O)CC(=O)Nc1ccon1 |
| InChI | InChI=1S/C7H8N2O3/c1-5(10)4-7(11)8-6-2-3-12-9-6/h2-3H,4H2,1H3,(H,8,9,11) |
| InChIKey | RWLAFZMDLIYJIM-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|