C7H11N3O2 — CID 62903598
4-amino-N-(1,2-oxazol-3-yl)butanamide (PubChem CID 62903598) has the molecular formula C7H11N3O2 and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-amino-N-(1,2-oxazol-3-yl)butanamide.
| Compound Name | 4-amino-N-(1,2-oxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 62903598 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4-amino-N-(1,2-oxazol-3-yl)butanamide |
| SMILES | NCCCC(=O)Nc1ccon1 |
| InChI | InChI=1S/C7H11N3O2/c8-4-1-2-7(11)9-6-3-5-12-10-6/h3,5H,1-2,4,8H2,(H,9,10,11) |
| InChIKey | WBWMXIWKLQYXKJ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |