C8H12N2O4 — CID 103895196
2-(2-methoxyethoxy)-N-(1,2-oxazol-3-yl)acetamide (PubChem CID 103895196) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(1,2-oxazol-3-yl)acetamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 103895196 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(1,2-oxazol-3-yl)acetamide |
| SMILES | COCCOCC(=O)Nc1ccon1 |
| InChI | InChI=1S/C8H12N2O4/c1-12-4-5-13-6-8(11)9-7-2-3-14-10-7/h2-3H,4-6H2,1H3,(H,9,10,11) |
| InChIKey | ORSBNFKLGABGGN-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 73.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|