C6H6N2O4 — CID 112617179
methyl 2-(1,2-oxazol-3-ylamino)-2-oxoacetate (PubChem CID 112617179) has the molecular formula C6H6N2O4 and a molecular weight of 170.12 g/mol. Its IUPAC name is methyl 2-(1,2-oxazol-3-ylamino)-2-oxoacetate.
| Compound Name | methyl 2-(1,2-oxazol-3-ylamino)-2-oxoacetate |
|---|---|
| PubChem CID | 112617179 |
| Molecular Formula | C6H6N2O4 |
| Molecular Weight | 170.12 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | methyl 2-(1,2-oxazol-3-ylamino)-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1ccon1 |
| InChI | InChI=1S/C6H6N2O4/c1-11-6(10)5(9)7-4-2-3-12-8-4/h2-3H,1H3,(H,7,8,9) |
| InChIKey | SKRPOKJAZISDAQ-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.12 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|