C5H4F2N2O2 — CID 103515463
2,2-difluoro-N-(1,2-oxazol-3-yl)acetamide (PubChem CID 103515463) has the molecular formula C5H4F2N2O2 and a molecular weight of 162.10 g/mol. Its IUPAC name is 2,2-difluoro-N-(1,2-oxazol-3-yl)acetamide.
| Compound Name | 2,2-difluoro-N-(1,2-oxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 103515463 |
| Molecular Formula | C5H4F2N2O2 |
| Molecular Weight | 162.10 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | 2,2-difluoro-N-(1,2-oxazol-3-yl)acetamide |
| SMILES | O=C(Nc1ccon1)C(F)F |
| InChI | InChI=1S/C5H4F2N2O2/c6-4(7)5(10)8-3-1-2-11-9-3/h1-2,4H,(H,8,9,10) |
| InChIKey | OHJDBYSLYRUYGW-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.10 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |