C13H13FN2O3 — CID 17249225
2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)butanamide (PubChem CID 17249225) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)butanamide.
| Compound Name | 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 17249225 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)butanamide |
| SMILES | CCC(Oc1ccc(F)cc1)C(=O)Nc1ccon1 |
| InChI | InChI=1S/C13H13FN2O3/c1-2-11(13(17)15-12-7-8-18-16-12)19-10-5-3-9(14)4-6-10/h3-8,11H,2H2,1H3,(H,15,16,17) |
| InChIKey | ULBAQADDZJNYHG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |