C14H16N2O3 — CID 27233380
(2R)-2-(4-methylphenoxy)-N-(1,2-oxazol-3-yl)butanamide (PubChem CID 27233380) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2R)-2-(4-methylphenoxy)-N-(1,2-oxazol-3-yl)butanamide.
| Compound Name | (2R)-2-(4-methylphenoxy)-N-(1,2-oxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 27233380 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (2R)-2-(4-methylphenoxy)-N-(1,2-oxazol-3-yl)butanamide |
| SMILES | CC[C@@H](Oc1ccc(C)cc1)C(=O)Nc1ccon1 |
| InChI | InChI=1S/C14H16N2O3/c1-3-12(14(17)15-13-8-9-18-16-13)19-11-6-4-10(2)5-7-11/h4-9,12H,3H2,1-2H3,(H,15,16,17)/t12-/m1/s1 |
| InChIKey | QPHHADIQYVWMFT-GFCCVEGCSA-N |
| XLogP | 2.78 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |