C18H24N2O3 — CID 24533965
2-(4-butan-2-ylphenoxy)-N-(5-methyl-1,2-oxazol-3-yl)butanamide (PubChem CID 24533965) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenoxy)-N-(5-methyl-1,2-oxazol-3-yl)butanamide.
| Compound Name | 2-(4-butan-2-ylphenoxy)-N-(5-methyl-1,2-oxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 24533965 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 2-(4-butan-2-ylphenoxy)-N-(5-methyl-1,2-oxazol-3-yl)butanamide |
| SMILES | CCC(Oc1ccc(C(C)CC)cc1)C(=O)Nc1cc(C)on1 |
| InChI | InChI=1S/C18H24N2O3/c1-5-12(3)14-7-9-15(10-8-14)22-16(6-2)18(21)19-17-11-13(4)23-20-17/h7-12,16H,5-6H2,1-4H3,(H,19,20,21) |
| InChIKey | IHXYRMSTOOBINL-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |